C20H34NO2P — CID 46702321
N-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]butan-1-amine (PubChem CID 46702321) has the molecular formula C20H34NO2P and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]butan-1-amine.
| Compound Name | N-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]butan-1-amine |
|---|---|
| PubChem CID | 46702321 |
| Molecular Formula | C20H34NO2P |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]butan-1-amine |
| SMILES | CCCCN[P@@](=O)(O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H34NO2P/c1-5-6-14-21-24(22,18-10-8-7-9-11-18)23-20-15-17(4)12-13-19(20)16(2)3/h7-11,16-17,19-20H,5-6,12-15H2,1-4H3,(H,21,22)/t17-,19+,20-,24-/m0/s1 |
| InChIKey | LSOGZDLDYBRFQQ-GHCZAOPSSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|