C22H38O5P2 — CID 11604696
[2-diethoxyphosphorylethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene (PubChem CID 11604696) has the molecular formula C22H38O5P2 and a molecular weight of 444.49 g/mol. Its IUPAC name is [2-diethoxyphosphorylethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene.
| Compound Name | [2-diethoxyphosphorylethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene |
|---|---|
| PubChem CID | 11604696 |
| Molecular Formula | C22H38O5P2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [2-diethoxyphosphorylethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene |
| SMILES | CCOP(=O)(CC[P@](=O)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1)OCC |
| InChI | InChI=1S/C22H38O5P2/c1-6-25-29(24,26-7-2)16-15-28(23,20-11-9-8-10-12-20)27-22-17-19(5)13-14-21(22)18(3)4/h8-12,18-19,21-22H,6-7,13-17H2,1-5H3/t19-,21+,22-,28+/m1/s1 |
| InChIKey | DAOWQAIRISDLJR-YTBIZOFCSA-N |
| XLogP | 6.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|