C24H33O2PS — CID 11582440
[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-(2-phenylsulfanylethyl)phosphoryl]benzene (PubChem CID 11582440) has the molecular formula C24H33O2PS and a molecular weight of 416.57 g/mol. Its IUPAC name is [[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-(2-phenylsulfanylethyl)phosphoryl]benzene.
| Compound Name | [[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-(2-phenylsulfanylethyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 11582440 |
| Molecular Formula | C24H33O2PS |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-(2-phenylsulfanylethyl)phosphoryl]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[P@@](=O)(CCSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33O2PS/c1-19(2)23-15-14-20(3)18-24(23)26-27(25,21-10-6-4-7-11-21)16-17-28-22-12-8-5-9-13-22/h4-13,19-20,23-24H,14-18H2,1-3H3/t20-,23+,24-,27+/m1/s1 |
| InChIKey | KLRONDRTIDGMQU-ULGZCJNSSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|