C24H43O5PSi — CID 11655780
triethoxy-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethyl]silane (PubChem CID 11655780) has the molecular formula C24H43O5PSi and a molecular weight of 470.66 g/mol. Its IUPAC name is triethoxy-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethyl]silane.
| Compound Name | triethoxy-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethyl]silane |
|---|---|
| PubChem CID | 11655780 |
| Molecular Formula | C24H43O5PSi |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | triethoxy-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethyl]silane |
| SMILES | CCO[Si](CC[P@](=O)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C24H43O5PSi/c1-7-26-31(27-8-2,28-9-3)18-17-30(25,22-13-11-10-12-14-22)29-24-19-21(6)15-16-23(24)20(4)5/h10-14,20-21,23-24H,7-9,15-19H2,1-6H3/t21-,23+,24-,30+/m1/s1 |
| InChIKey | ZMHIPCYUDMGDCD-YINFAOLWSA-N |
| XLogP | 6.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|