C18H29OPS — CID 23415856
ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-sulfanylidene-λ5-phosphane (PubChem CID 23415856) has the molecular formula C18H29OPS and a molecular weight of 324.47 g/mol. Its IUPAC name is ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-sulfanylidene-λ5-phosphane.
| Compound Name | ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23415856 |
| Molecular Formula | C18H29OPS |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-sulfanylidene-λ5-phosphane |
| SMILES | CCP(=S)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29OPS/c1-5-20(21,16-9-7-6-8-10-16)19-18-13-15(4)11-12-17(18)14(2)3/h6-10,14-15,17-18H,5,11-13H2,1-4H3/t15-,17+,18-,20?/m1/s1 |
| InChIKey | LIEZOBOOXOONDO-AUSZYXGQSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|