C23H32NO2P — CID 11909076
N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-phenylmethanamine (PubChem CID 11909076) has the molecular formula C23H32NO2P and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-phenylmethanamine.
| Compound Name | N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 11909076 |
| Molecular Formula | C23H32NO2P |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-phenylmethanamine |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[P@](=O)(NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32NO2P/c1-18(2)22-15-14-19(3)16-23(22)26-27(25,21-12-8-5-9-13-21)24-17-20-10-6-4-7-11-20/h4-13,18-19,22-23H,14-17H2,1-3H3,(H,24,25)/t19-,22+,23-,27+/m1/s1 |
| InChIKey | HJIGZBPJUFYJDC-KDKQAMIGSA-N |
| XLogP | 5.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|