C24H31O2P — CID 121493806
[(E)-2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethenyl]benzene (PubChem CID 121493806) has the molecular formula C24H31O2P and a molecular weight of 382.48 g/mol. Its IUPAC name is [(E)-2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethenyl]benzene.
| Compound Name | [(E)-2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethenyl]benzene |
|---|---|
| PubChem CID | 121493806 |
| Molecular Formula | C24H31O2P |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [(E)-2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]ethenyl]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OP(=O)(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31O2P/c1-19(2)23-15-14-20(3)18-24(23)26-27(25,22-12-8-5-9-13-22)17-16-21-10-6-4-7-11-21/h4-13,16-17,19-20,23-24H,14-15,18H2,1-3H3/b17-16+/t20-,23+,24-,27?/m1/s1 |
| InChIKey | IOUILGKMTNTRBA-KVBPVLQASA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|