C28H46NO5P — CID 40806317
[(1R)-1-[[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-2-nitroethyl]benzene (PubChem CID 40806317) has the molecular formula C28H46NO5P and a molecular weight of 507.65 g/mol. Its IUPAC name is [(1R)-1-[[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-2-nitroethyl]benzene.
| Compound Name | [(1R)-1-[[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-2-nitroethyl]benzene |
|---|---|
| PubChem CID | 40806317 |
| Molecular Formula | C28H46NO5P |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | [(1R)-1-[[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-2-nitroethyl]benzene |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OP(=O)(O[C@@H]1C[C@@H](C)CC[C@H]1C(C)C)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C28H46NO5P/c1-19(2)24-14-12-21(5)16-26(24)33-35(32,28(18-29(30)31)23-10-8-7-9-11-23)34-27-17-22(6)13-15-25(27)20(3)4/h7-11,19-22,24-28H,12-18H2,1-6H3/t21-,22+,24-,25+,26-,27-,28+,35?/m1/s1 |
| InChIKey | VAMMHMBTLSBKCE-FNHUQLNKSA-N |
| XLogP | 8.15 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|