C30H51N2O5P — CID 124775061
4-[(1S)-1-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-2-nitroethyl]-N,N-dimethylaniline (PubChem CID 124775061) has the molecular formula C30H51N2O5P and a molecular weight of 550.72 g/mol. Its IUPAC name is 4-[(1S)-1-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-2-nitroethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1S)-1-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-2-nitroethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 124775061 |
| Molecular Formula | C30H51N2O5P |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 4-[(1S)-1-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-2-nitroethyl]-N,N-dimethylaniline |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OP(=O)(O[C@@H]1C[C@H](C)CC[C@@H]1C(C)C)[C@H](C[N+](=O)[O-])c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C30H51N2O5P/c1-20(2)26-15-9-22(5)17-28(26)36-38(35,37-29-18-23(6)10-16-27(29)21(3)4)30(19-32(33)34)24-11-13-25(14-12-24)31(7)8/h11-14,20-23,26-30H,9-10,15-19H2,1-8H3/t22-,23-,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | VFILCUMPYXSAII-OSRCPPLOSA-N |
| XLogP | 8.22 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|