C17H25NOS — CID 43100670
2-(5-methyl-2-propan-2-ylcyclohexyl)oxybenzenecarbothioamide (PubChem CID 43100670) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylcyclohexyl)oxybenzenecarbothioamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 43100670 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxybenzenecarbothioamide |
| SMILES | CC1CCC(C(C)C)C(Oc2ccccc2C(N)=S)C1 |
| InChI | InChI=1S/C17H25NOS/c1-11(2)13-9-8-12(3)10-16(13)19-15-7-5-4-6-14(15)17(18)20/h4-7,11-13,16H,8-10H2,1-3H3,(H2,18,20) |
| InChIKey | JKTMBDXCKZNSCM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|