C20H32OSi — CID 102005829
methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenyl-prop-2-enylsilane (PubChem CID 102005829) has the molecular formula C20H32OSi and a molecular weight of 316.56 g/mol. Its IUPAC name is methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenyl-prop-2-enylsilane.
| Compound Name | methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 102005829 |
| Molecular Formula | C20H32OSi |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenyl-prop-2-enylsilane |
| SMILES | C=CC[Si@](C)(OC1CC(C)CCC1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H32OSi/c1-6-14-22(5,18-10-8-7-9-11-18)21-20-15-17(4)12-13-19(20)16(2)3/h6-11,16-17,19-20H,1,12-15H2,2-5H3/t17?,19?,20?,22-/m0/s1 |
| InChIKey | MBVZLXFBQNUAFE-GBUUITIBSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|