C20H29O3P — CID 13256475
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[ethenyl(phenyl)phosphoryl]acetate (PubChem CID 13256475) has the molecular formula C20H29O3P and a molecular weight of 348.42 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[ethenyl(phenyl)phosphoryl]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[ethenyl(phenyl)phosphoryl]acetate |
|---|---|
| PubChem CID | 13256475 |
| Molecular Formula | C20H29O3P |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[ethenyl(phenyl)phosphoryl]acetate |
| SMILES | C=C[P@@](=O)(CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H29O3P/c1-5-24(22,17-9-7-6-8-10-17)14-20(21)23-19-13-16(4)11-12-18(19)15(2)3/h5-10,15-16,18-19H,1,11-14H2,2-4H3/t16-,18+,19-,24-/m1/s1 |
| InChIKey | ANMPTNPZGPNOBH-HOBQYKGVSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|