C16H25BOP — CID 6365001
CID 6365001 (PubChem CID 6365001) has the molecular formula C16H25BOP and a molecular weight of 275.16 g/mol.
| Compound Name | CID 6365001 |
|---|---|
| PubChem CID | 6365001 |
| Molecular Formula | C16H25BOP |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | — |
| SMILES | [B-][PH+](O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H25BOP/c1-12(2)15-10-9-13(3)11-16(15)18-19(17)14-7-5-4-6-8-14/h4-8,12-13,15-16,19H,9-11H2,1-3H3/t13-,15+,16-/m1/s1 |
| InChIKey | OFJKSOHKECBXNM-VNQPRFMTSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|