C17H26N2O2 — CID 154685218
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-anilinocarbamate (PubChem CID 154685218) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-anilinocarbamate.
| Compound Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-anilinocarbamate |
|---|---|
| PubChem CID | 154685218 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-anilinocarbamate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC1OC(=O)NNc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-12(2)15-10-9-13(3)11-16(15)21-17(20)19-18-14-7-5-4-6-8-14/h4-8,12-13,15-16,18H,9-11H2,1-3H3,(H,19,20)/t13-,15+,16?/m1/s1 |
| InChIKey | MHHFDJASJBLLEJ-YISXUXMPSA-N |
| XLogP | 4.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|