C17H26N2O — CID 175475904
5-methyl-N'-phenyl-2-propan-2-ylcyclohexane-1-carbohydrazide (PubChem CID 175475904) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 5-methyl-N'-phenyl-2-propan-2-ylcyclohexane-1-carbohydrazide.
| Compound Name | 5-methyl-N'-phenyl-2-propan-2-ylcyclohexane-1-carbohydrazide |
|---|---|
| PubChem CID | 175475904 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 5-methyl-N'-phenyl-2-propan-2-ylcyclohexane-1-carbohydrazide |
| SMILES | CC1CCC(C(C)C)C(C(=O)NNc2ccccc2)C1 |
| InChI | InChI=1S/C17H26N2O/c1-12(2)15-10-9-13(3)11-16(15)17(20)19-18-14-7-5-4-6-8-14/h4-8,12-13,15-16,18H,9-11H2,1-3H3,(H,19,20) |
| InChIKey | PQHSEUYECIQUDQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|