C24H45NO — CID 91604695
N-benzyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;ethane (PubChem CID 91604695) has the molecular formula C24H45NO and a molecular weight of 363.63 g/mol. Its IUPAC name is N-benzyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;ethane.
| Compound Name | N-benzyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 91604695 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | N-benzyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;ethane |
| SMILES | CC.CC.CC.CC1CCC(C(C)C)C(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C18H27NO.3C2H6/c1-13(2)16-10-9-14(3)11-17(16)18(20)19-12-15-7-5-4-6-8-15;3*1-2/h4-8,13-14,16-17H,9-12H2,1-3H3,(H,19,20);3*1-2H3 |
| InChIKey | QBQSEOFZXIEEJR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |