C19H29NO — CID 68625601
5-methyl-N-(2-phenylethyl)-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 68625601) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 5-methyl-N-(2-phenylethyl)-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 5-methyl-N-(2-phenylethyl)-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 68625601 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 5-methyl-N-(2-phenylethyl)-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(C)C)C(C(=O)NCCc2ccccc2)C1 |
| InChI | InChI=1S/C19H29NO/c1-14(2)17-10-9-15(3)13-18(17)19(21)20-12-11-16-7-5-4-6-8-16/h4-8,14-15,17-18H,9-13H2,1-3H3,(H,20,21) |
| InChIKey | NEKQQRBWRFVKGO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |