C19H28BrNO — CID 66831515
N-[2-(2-bromophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 66831515) has the molecular formula C19H28BrNO and a molecular weight of 366.34 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-[2-(2-bromophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66831515 |
| Molecular Formula | C19H28BrNO |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[2-(2-bromophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(C)C)C(C(=O)NCCc2ccccc2Br)C1 |
| InChI | InChI=1S/C19H28BrNO/c1-13(2)16-9-8-14(3)12-17(16)19(22)21-11-10-15-6-4-5-7-18(15)20/h4-7,13-14,16-17H,8-12H2,1-3H3,(H,21,22) |
| InChIKey | FLQYGDTTZDIAAX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |