C24H41N2O2+ — CID 167121855
trimethyl-[2-[2-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]ethyl]phenoxy]ethyl]azanium (PubChem CID 167121855) has the molecular formula C24H41N2O2+ and a molecular weight of 389.60 g/mol. Its IUPAC name is trimethyl-[2-[2-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]ethyl]phenoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[2-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]ethyl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 167121855 |
| Molecular Formula | C24H41N2O2+ |
| Molecular Weight | 389.60 g/mol |
| Exact Mass | 389.32 |
| IUPAC Name | trimethyl-[2-[2-[2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]ethyl]phenoxy]ethyl]azanium |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)NCCc1ccccc1OCC[N+](C)(C)C |
| InChI | InChI=1S/C24H40N2O2/c1-18(2)21-12-11-19(3)17-22(21)24(27)25-14-13-20-9-7-8-10-23(20)28-16-15-26(4,5)6/h7-10,18-19,21-22H,11-17H2,1-6H3/p+1/t19-,21+,22-/m1/s1 |
| InChIKey | SWSUCXRBGQZNSR-BAGYTPMASA-O |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|