C19H27NO3 — CID 69229253
methyl 2-[(5-methyl-2-propan-2-ylcyclohexanecarbonyl)amino]benzoate (PubChem CID 69229253) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is methyl 2-[(5-methyl-2-propan-2-ylcyclohexanecarbonyl)amino]benzoate.
| Compound Name | methyl 2-[(5-methyl-2-propan-2-ylcyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 69229253 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | methyl 2-[(5-methyl-2-propan-2-ylcyclohexanecarbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C19H27NO3/c1-12(2)14-10-9-13(3)11-16(14)18(21)20-17-8-6-5-7-15(17)19(22)23-4/h5-8,12-14,16H,9-11H2,1-4H3,(H,20,21) |
| InChIKey | GLQLVKREISJOMQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |