C16H24O3S — CID 11033794
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzenesulfonate (PubChem CID 11033794) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzenesulfonate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzenesulfonate |
|---|---|
| PubChem CID | 11033794 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzenesulfonate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O3S/c1-12(2)15-10-9-13(3)11-16(15)19-20(17,18)14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3/t13-,15+,16-/m1/s1 |
| InChIKey | JKHRVEWNCCTSDN-VNQPRFMTSA-N |
| XLogP | 3.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|