C16H25NO2S — CID 42960041
N-(5-methyl-2-propan-2-ylcyclohexyl)benzenesulfonamide (PubChem CID 42960041) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-(5-methyl-2-propan-2-ylcyclohexyl)benzenesulfonamide.
| Compound Name | N-(5-methyl-2-propan-2-ylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42960041 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(5-methyl-2-propan-2-ylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCC(C(C)C)C(NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H25NO2S/c1-12(2)15-10-9-13(3)11-16(15)17-20(18,19)14-7-5-4-6-8-14/h4-8,12-13,15-17H,9-11H2,1-3H3 |
| InChIKey | ZRDQBSAADJWAKU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |