C20H30N2O3S — CID 55662861
4-(cyclopropylsulfamoyl)-N-(5-methyl-2-propan-2-ylcyclohexyl)benzamide (PubChem CID 55662861) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-(5-methyl-2-propan-2-ylcyclohexyl)benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-(5-methyl-2-propan-2-ylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 55662861 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-(5-methyl-2-propan-2-ylcyclohexyl)benzamide |
| SMILES | CC1CCC(C(C)C)C(NC(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)C1 |
| InChI | InChI=1S/C20H30N2O3S/c1-13(2)18-11-4-14(3)12-19(18)21-20(23)15-5-9-17(10-6-15)26(24,25)22-16-7-8-16/h5-6,9-10,13-14,16,18-19,22H,4,7-8,11-12H2,1-3H3,(H,21,23) |
| InChIKey | ZZATZCREGJOOPU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |