C17H25NO3S — CID 46485032
N-(4-methylcyclohexyl)-4-propan-2-ylsulfonylbenzamide (PubChem CID 46485032) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-4-propan-2-ylsulfonylbenzamide.
| Compound Name | N-(4-methylcyclohexyl)-4-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46485032 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(4-methylcyclohexyl)-4-propan-2-ylsulfonylbenzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(S(=O)(=O)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C17H25NO3S/c1-12(2)22(20,21)16-10-6-14(7-11-16)17(19)18-15-8-4-13(3)5-9-15/h6-7,10-13,15H,4-5,8-9H2,1-3H3,(H,18,19) |
| InChIKey | XZPGZHAFQBUJKX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |