C16H26NO2P — CID 175008628
N-(5-methyl-2-propan-2-ylcyclohexyl)-phenylphosphonamidic acid (PubChem CID 175008628) has the molecular formula C16H26NO2P and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(5-methyl-2-propan-2-ylcyclohexyl)-phenylphosphonamidic acid.
| Compound Name | N-(5-methyl-2-propan-2-ylcyclohexyl)-phenylphosphonamidic acid |
|---|---|
| PubChem CID | 175008628 |
| Molecular Formula | C16H26NO2P |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(5-methyl-2-propan-2-ylcyclohexyl)-phenylphosphonamidic acid |
| SMILES | CC1CCC(C(C)C)C(NP(=O)(O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H26NO2P/c1-12(2)15-10-9-13(3)11-16(15)17-20(18,19)14-7-5-4-6-8-14/h4-8,12-13,15-16H,9-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | JDBUNFGHFNPMFQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|