C24H34O5S2 — CID 159733271
benzyl-(4-hydroxyphenyl)-methylsulfanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate (PubChem CID 159733271) has the molecular formula C24H34O5S2 and a molecular weight of 466.67 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate.
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate |
|---|---|
| PubChem CID | 159733271 |
| Molecular Formula | C24H34O5S2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate |
| SMILES | CC1CCC(C(C)C)C(OS(=O)(=O)[O-])C1.C[S+](Cc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H14OS.C10H20O4S/c1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14;1-7(2)9-5-4-8(3)6-10(9)14-15(11,12)13/h2-10H,11H2,1H3;7-10H,4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | NBMVZVKAAPBBHO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|