C17H18F4O5S2 — CID 159955648
benzyl-(4-hydroxyphenyl)-methylsulfanium;2,2,3,3-tetrafluoropropyl sulfate (PubChem CID 159955648) has the molecular formula C17H18F4O5S2 and a molecular weight of 442.45 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;2,2,3,3-tetrafluoropropyl sulfate.
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;2,2,3,3-tetrafluoropropyl sulfate |
|---|---|
| PubChem CID | 159955648 |
| Molecular Formula | C17H18F4O5S2 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;2,2,3,3-tetrafluoropropyl sulfate |
| SMILES | C[S+](Cc1ccccc1)c1ccc(O)cc1.O=S(=O)([O-])OCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H14OS.C3H4F4O4S/c1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14;4-2(5)3(6,7)1-11-12(8,9)10/h2-10H,11H2,1H3;2H,1H2,(H,8,9,10) |
| InChIKey | OCRGZWUVPUKJFS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|