About benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate
benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate (PubChem CID 161263082) has the molecular formula C28H26O6S2
and a molecular weight of 522.64 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate.
Molecular Properties
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate |
| PubChem CID | 161263082 |
| Molecular Formula | C28H26O6S2 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate |
| SMILES | C[S+](Cc1ccccc1)c1ccc(O)cc1.O=C(c1ccccc1)C(OS(=O)(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H12O5S.C14H14OS/c15-13(11-7-3-1-4-8-11)14(19-20(16,17)18)12-9-5-2-6-10-12;1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14/h1-10,14H,(H,16,17,18);2-10H,11H2,1H3 |
| InChIKey | VCUWRBTUPHNADW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate?
The IUPAC name of benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate (CID 161263082) is benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate.
What is the SMILES notation for benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate?
The canonical SMILES for benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate is C[S+](Cc1ccccc1)c1ccc(O)cc1.O=C(c1ccccc1)C(OS(=O)(=O)[O-])c1ccccc1.
What is the InChIKey of benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate?
The InChIKey is VCUWRBTUPHNADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O5S.C14H14OS/c15-13(11-7-3-1-4-8-11)14(19-20(16,17)18)12-9-5-2-6-10-12;1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14/h1-10,14H,(H,16,17,18);2-10H,11H2,1H3.
What are the key properties of benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate?
benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate has a molecular weight of 522.64 g/mol, XLogP of 5.29, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-oxo-1,2-diphenylethyl) sulfate is sourced from PubChem (CID 161263082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).