C14H12NO5S- — CID 140628952
[(2Z)-2-hydroxyimino-1,2-diphenylethyl] sulfate (PubChem CID 140628952) has the molecular formula C14H12NO5S- and a molecular weight of 306.32 g/mol. Its IUPAC name is [(2Z)-2-hydroxyimino-1,2-diphenylethyl] sulfate.
| Compound Name | [(2Z)-2-hydroxyimino-1,2-diphenylethyl] sulfate |
|---|---|
| PubChem CID | 140628952 |
| Molecular Formula | C14H12NO5S- |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | [(2Z)-2-hydroxyimino-1,2-diphenylethyl] sulfate |
| SMILES | O=S(=O)([O-])OC(/C(=N\O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13NO5S/c16-15-13(11-7-3-1-4-8-11)14(20-21(17,18)19)12-9-5-2-6-10-12/h1-10,14,16H,(H,17,18,19)/p-1/b15-13- |
| InChIKey | UCDZUNLBHZBDFP-SQFISAMPSA-M |
| XLogP | 2.08 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|