C23H20N2O4S — CID 142494385
[(2E)-2-(benzenesulfonylhydrazinylidene)-1,2-diphenylethyl] prop-2-enoate (PubChem CID 142494385) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is [(2E)-2-(benzenesulfonylhydrazinylidene)-1,2-diphenylethyl] prop-2-enoate.
| Compound Name | [(2E)-2-(benzenesulfonylhydrazinylidene)-1,2-diphenylethyl] prop-2-enoate |
|---|---|
| PubChem CID | 142494385 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [(2E)-2-(benzenesulfonylhydrazinylidene)-1,2-diphenylethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(/C(=N/NS(=O)(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O4S/c1-2-21(26)29-23(19-14-8-4-9-15-19)22(18-12-6-3-7-13-18)24-25-30(27,28)20-16-10-5-11-17-20/h2-17,23,25H,1H2/b24-22+ |
| InChIKey | HRRDHXYULKITFP-ZNTNEXAZSA-N |
| XLogP | 3.84 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|