C27H28N2O3S — CID 24766107
4-methyl-N-[(E)-[(3E)-4-methyl-1-phenyl-1-phenylmethoxyhexa-3,5-dien-2-ylidene]amino]benzenesulfonamide (PubChem CID 24766107) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 4-methyl-N-[(E)-[(3E)-4-methyl-1-phenyl-1-phenylmethoxyhexa-3,5-dien-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-[(3E)-4-methyl-1-phenyl-1-phenylmethoxyhexa-3,5-dien-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 24766107 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-methyl-N-[(E)-[(3E)-4-methyl-1-phenyl-1-phenylmethoxyhexa-3,5-dien-2-ylidene]amino]benzenesulfonamide |
| SMILES | C=C/C(C)=C/C(=N\NS(=O)(=O)c1ccc(C)cc1)C(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O3S/c1-4-21(2)19-26(28-29-33(30,31)25-17-15-22(3)16-18-25)27(24-13-9-6-10-14-24)32-20-23-11-7-5-8-12-23/h4-19,27,29H,1,20H2,2-3H3/b21-19+,28-26+ |
| InChIKey | GEYJJAKXBMJTME-PACVJADRSA-N |
| XLogP | 5.72 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|