C18H22N2O3S — CID 177447392
4-methyl-N-[(E)-4-phenylmethoxybutan-2-ylideneamino]benzenesulfonamide (PubChem CID 177447392) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-methyl-N-[(E)-4-phenylmethoxybutan-2-ylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-4-phenylmethoxybutan-2-ylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 177447392 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-methyl-N-[(E)-4-phenylmethoxybutan-2-ylideneamino]benzenesulfonamide |
| SMILES | C/C(CCOCc1ccccc1)=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-15-8-10-18(11-9-15)24(21,22)20-19-16(2)12-13-23-14-17-6-4-3-5-7-17/h3-11,20H,12-14H2,1-2H3/b19-16+ |
| InChIKey | WPFAFBKXJHXBFP-KNTRCKAVSA-N |
| XLogP | 3.26 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|