C16H18N2O4S2 — CID 137357878
N-[(E)-1-(benzenesulfonyl)propan-2-ylideneamino]-4-methylbenzenesulfonamide (PubChem CID 137357878) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(E)-1-(benzenesulfonyl)propan-2-ylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-1-(benzenesulfonyl)propan-2-ylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 137357878 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N-[(E)-1-(benzenesulfonyl)propan-2-ylideneamino]-4-methylbenzenesulfonamide |
| SMILES | C/C(CS(=O)(=O)c1ccccc1)=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-13-8-10-16(11-9-13)24(21,22)18-17-14(2)12-23(19,20)15-6-4-3-5-7-15/h3-11,18H,12H2,1-2H3/b17-14+ |
| InChIKey | PQHYTIBXKYDWNW-SAPNQHFASA-N |
| XLogP | 2.12 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|