C14H15NO4S2 — CID 23452751
N-[(4-methylphenyl)sulfonylmethyl]benzenesulfonamide (PubChem CID 23452751) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[(4-methylphenyl)sulfonylmethyl]benzenesulfonamide.
| Compound Name | N-[(4-methylphenyl)sulfonylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23452751 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[(4-methylphenyl)sulfonylmethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)CNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H15NO4S2/c1-12-7-9-13(10-8-12)20(16,17)11-15-21(18,19)14-5-3-2-4-6-14/h2-10,15H,11H2,1H3 |
| InChIKey | FKHVDNFEYUAYRC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |