C21H20N2O2S — CID 6370396
N-[(E)-1,2-diphenylethylideneamino]-4-methylbenzenesulfonamide (PubChem CID 6370396) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(E)-1,2-diphenylethylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-1,2-diphenylethylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6370396 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(E)-1,2-diphenylethylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(\Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-17-12-14-20(15-13-17)26(24,25)23-22-21(19-10-6-3-7-11-19)16-18-8-4-2-5-9-18/h2-15,23H,16H2,1H3/b22-21+ |
| InChIKey | INMYHVHTZKDKDK-QURGRASLSA-N |
| XLogP | 3.92 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|