C18H20N2O4S — CID 118198075
methyl N-(4-methylphenyl)sulfonyl-4-oxo-4-phenylbutanehydrazonate (PubChem CID 118198075) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is methyl N-(4-methylphenyl)sulfonyl-4-oxo-4-phenylbutanehydrazonate.
| Compound Name | methyl N-(4-methylphenyl)sulfonyl-4-oxo-4-phenylbutanehydrazonate |
|---|---|
| PubChem CID | 118198075 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | methyl N-(4-methylphenyl)sulfonyl-4-oxo-4-phenylbutanehydrazonate |
| SMILES | COC(CCC(=O)c1ccccc1)=NNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-14-8-10-16(11-9-14)25(22,23)20-19-18(24-2)13-12-17(21)15-6-4-3-5-7-15/h3-11,20H,12-13H2,1-2H3 |
| InChIKey | LIBZVOWFGOZLFJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|