C13H16N2O6S — CID 2798179
dimethyl 2-[(4-methylphenyl)sulfonylhydrazinylidene]butanedioate (PubChem CID 2798179) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is dimethyl 2-[(4-methylphenyl)sulfonylhydrazinylidene]butanedioate.
| Compound Name | dimethyl 2-[(4-methylphenyl)sulfonylhydrazinylidene]butanedioate |
|---|---|
| PubChem CID | 2798179 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | dimethyl 2-[(4-methylphenyl)sulfonylhydrazinylidene]butanedioate |
| SMILES | COC(=O)CC(=NNS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
| InChI | InChI=1S/C13H16N2O6S/c1-9-4-6-10(7-5-9)22(18,19)15-14-11(13(17)21-3)8-12(16)20-2/h4-7,15H,8H2,1-3H3 |
| InChIKey | PPPCBSPJFJVODX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|