C19H21BrN2O5S — CID 23628624
ethyl (2Z)-2-(2-bromo-6-methoxy-4-methylphenyl)-2-[(4-methylphenyl)sulfonylhydrazinylidene]acetate (PubChem CID 23628624) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is ethyl (2Z)-2-(2-bromo-6-methoxy-4-methylphenyl)-2-[(4-methylphenyl)sulfonylhydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-(2-bromo-6-methoxy-4-methylphenyl)-2-[(4-methylphenyl)sulfonylhydrazinylidene]acetate |
|---|---|
| PubChem CID | 23628624 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | ethyl (2Z)-2-(2-bromo-6-methoxy-4-methylphenyl)-2-[(4-methylphenyl)sulfonylhydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(=N\NS(=O)(=O)c1ccc(C)cc1)c1c(Br)cc(C)cc1OC |
| InChI | InChI=1S/C19H21BrN2O5S/c1-5-27-19(23)18(17-15(20)10-13(3)11-16(17)26-4)21-22-28(24,25)14-8-6-12(2)7-9-14/h6-11,22H,5H2,1-4H3/b21-18- |
| InChIKey | LYDNPRPHPLFDJD-UZYVYHOESA-N |
| XLogP | 3.32 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|