C21H26BrNO7S — CID 74954972
ethyl 2-bromo-3-[(4-methylphenyl)sulfonylamino]-3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 74954972) has the molecular formula C21H26BrNO7S and a molecular weight of 516.41 g/mol. Its IUPAC name is ethyl 2-bromo-3-[(4-methylphenyl)sulfonylamino]-3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | ethyl 2-bromo-3-[(4-methylphenyl)sulfonylamino]-3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 74954972 |
| Molecular Formula | C21H26BrNO7S |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | ethyl 2-bromo-3-[(4-methylphenyl)sulfonylamino]-3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Br)C(NS(=O)(=O)c1ccc(C)cc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26BrNO7S/c1-6-30-21(24)18(22)19(23-31(25,26)15-9-7-13(2)8-10-15)14-11-16(27-3)20(29-5)17(12-14)28-4/h7-12,18-19,23H,6H2,1-5H3 |
| InChIKey | MLEHOIPXTPCFTJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|