C19H23NO7S — CID 139746749
ethyl 2-(benzenesulfonamido)-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoate (PubChem CID 139746749) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonamido)-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoate.
| Compound Name | ethyl 2-(benzenesulfonamido)-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 139746749 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | ethyl 2-(benzenesulfonamido)-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccccc1)C(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H23NO7S/c1-4-27-19(22)17(20-28(23,24)14-8-6-5-7-9-14)18(21)13-10-11-15(25-2)16(12-13)26-3/h5-12,17-18,20-21H,4H2,1-3H3 |
| InChIKey | USBVCQSSCBMKJQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |