C24H24N2O9S — CID 139746699
benzyl 3-(3,4-dimethoxyphenyl)-3-hydroxy-2-[(4-nitrophenyl)sulfonylamino]propanoate (PubChem CID 139746699) has the molecular formula C24H24N2O9S and a molecular weight of 516.53 g/mol. Its IUPAC name is benzyl 3-(3,4-dimethoxyphenyl)-3-hydroxy-2-[(4-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | benzyl 3-(3,4-dimethoxyphenyl)-3-hydroxy-2-[(4-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 139746699 |
| Molecular Formula | C24H24N2O9S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | benzyl 3-(3,4-dimethoxyphenyl)-3-hydroxy-2-[(4-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(C(O)C(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H24N2O9S/c1-33-20-13-8-17(14-21(20)34-2)23(27)22(24(28)35-15-16-6-4-3-5-7-16)25-36(31,32)19-11-9-18(10-12-19)26(29)30/h3-14,22-23,25,27H,15H2,1-2H3 |
| InChIKey | DNRMCBWYIGIJMA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|