C20H22N2O8S — CID 41169931
(4-nitrophenyl)methyl (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate (PubChem CID 41169931) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate.
| Compound Name | (4-nitrophenyl)methyl (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 41169931 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N2O8S/c1-13(2)19(20(23)30-12-14-3-5-15(6-4-14)22(24)25)21-31(26,27)16-7-8-17-18(11-16)29-10-9-28-17/h3-8,11,13,19,21H,9-10,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | KUHOVXHNKKWPMY-LJQANCHMSA-N |
| XLogP | 2.41 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|