C24H26N2O7S — CID 102189950
N-[(2R)-4-(3,4-dimethoxyphenyl)-1-hydroxy-1-phenylbutan-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 102189950) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[(2R)-4-(3,4-dimethoxyphenyl)-1-hydroxy-1-phenylbutan-2-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-4-(3,4-dimethoxyphenyl)-1-hydroxy-1-phenylbutan-2-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 102189950 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[(2R)-4-(3,4-dimethoxyphenyl)-1-hydroxy-1-phenylbutan-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | COc1ccc(CC[C@@H](NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C(O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H26N2O7S/c1-32-22-15-9-17(16-23(22)33-2)8-14-21(24(27)18-6-4-3-5-7-18)25-34(30,31)20-12-10-19(11-13-20)26(28)29/h3-7,9-13,15-16,21,24-25,27H,8,14H2,1-2H3/t21-,24?/m1/s1 |
| InChIKey | OOSUQLWIWVNIOA-CILPGNKCSA-N |
| XLogP | 3.63 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|