C19H25NO3 — CID 125467405
(1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-phenylpropan-1-ol (PubChem CID 125467405) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 125467405 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (1R,2S)-2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-phenylpropan-1-ol |
| SMILES | COc1ccc(CCN[C@@H](C)[C@H](O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H25NO3/c1-14(19(21)16-7-5-4-6-8-16)20-12-11-15-9-10-17(22-2)18(13-15)23-3/h4-10,13-14,19-21H,11-12H2,1-3H3/t14-,19-/m0/s1 |
| InChIKey | YUVHUSNUEUAIKC-LIRRHRJNSA-N |
| XLogP | 2.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |