C19H25NO4 — CID 667229
1-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]propan-1-ol (PubChem CID 667229) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 1-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]propan-1-ol.
| Compound Name | 1-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 667229 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]propan-1-ol |
| SMILES | COc1cc(OC)c(OC)cc1CNC(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-13(19(21)14-8-6-5-7-9-14)20-12-15-10-17(23-3)18(24-4)11-16(15)22-2/h5-11,13,19-21H,12H2,1-4H3 |
| InChIKey | BGXAAVCLMBIUIZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |