C19H23N3O5 — CID 8774840
(2R)-N-carbamoyl-2-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]acetamide (PubChem CID 8774840) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]acetamide.
| Compound Name | (2R)-N-carbamoyl-2-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 8774840 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (2R)-N-carbamoyl-2-phenyl-2-[(2,4,5-trimethoxyphenyl)methylamino]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1CN[C@@H](C(=O)NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O5/c1-25-14-10-16(27-3)15(26-2)9-13(14)11-21-17(18(23)22-19(20)24)12-7-5-4-6-8-12/h4-10,17,21H,11H2,1-3H3,(H3,20,22,23,24)/t17-/m1/s1 |
| InChIKey | QCHZAEBOJBXVKG-QGZVFWFLSA-N |
| XLogP | 1.74 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |