C18H20BrN3O3 — CID 9001607
(2R)-2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-carbamoyl-2-phenylacetamide (PubChem CID 9001607) has the molecular formula C18H20BrN3O3 and a molecular weight of 406.28 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-carbamoyl-2-phenylacetamide.
| Compound Name | (2R)-2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-carbamoyl-2-phenylacetamide |
|---|---|
| PubChem CID | 9001607 |
| Molecular Formula | C18H20BrN3O3 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (2R)-2-[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]-N-carbamoyl-2-phenylacetamide |
| SMILES | COc1ccc([C@H](C)N[C@@H](C(=O)NC(N)=O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C18H20BrN3O3/c1-11(13-8-9-15(25-2)14(19)10-13)21-16(17(23)22-18(20)24)12-6-4-3-5-7-12/h3-11,16,21H,1-2H3,(H3,20,22,23,24)/t11-,16+/m0/s1 |
| InChIKey | CTDPPJBWKFIIQY-MEDUHNTESA-N |
| XLogP | 3.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |