C17H18ClN3O2 — CID 8599213
(2S)-N-carbamoyl-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-phenylacetamide (PubChem CID 8599213) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-phenylacetamide.
| Compound Name | (2S)-N-carbamoyl-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 8599213 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2S)-N-carbamoyl-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-phenylacetamide |
| SMILES | C[C@H](N[C@H](C(=O)NC(N)=O)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-11(13-8-5-9-14(18)10-13)20-15(16(22)21-17(19)23)12-6-3-2-4-7-12/h2-11,15,20H,1H3,(H3,19,21,22,23)/t11-,15-/m0/s1 |
| InChIKey | QJWZXWHMJDHVGI-NHYWBVRUSA-N |
| XLogP | 2.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |