C19H22ClN3O2 — CID 8599191
(2R)-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-(ethylcarbamoyl)-2-phenylacetamide (PubChem CID 8599191) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-(ethylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-(ethylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 8599191 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2R)-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-(ethylcarbamoyl)-2-phenylacetamide |
| SMILES | CCNC(=O)NC(=O)[C@H](N[C@@H](C)c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-3-21-19(25)23-18(24)17(14-8-5-4-6-9-14)22-13(2)15-10-7-11-16(20)12-15/h4-13,17,22H,3H2,1-2H3,(H2,21,23,24,25)/t13-,17+/m0/s1 |
| InChIKey | NCVCQJDLJKWWDN-SUMWQHHRSA-N |
| XLogP | 3.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |