C17H27N3O3 — CID 51088764
N-(ethylcarbamoyl)-2-[1-(3-propan-2-yloxyphenyl)ethylamino]propanamide (PubChem CID 51088764) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[1-(3-propan-2-yloxyphenyl)ethylamino]propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[1-(3-propan-2-yloxyphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 51088764 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[1-(3-propan-2-yloxyphenyl)ethylamino]propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NC(C)c1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-6-18-17(22)20-16(21)13(5)19-12(4)14-8-7-9-15(10-14)23-11(2)3/h7-13,19H,6H2,1-5H3,(H2,18,20,21,22) |
| InChIKey | ZMALDYGMPLGECW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |